CAS 1283720-15-9

1,1-Dimethylethyl 2-(2,2,2-trifluoroacetyl)-1-piperidinecarboxylate

Description:

1,1-Dimethylethyl 2-(2,2,2-trifluoroacetyl)-1-piperidinecarboxylate, identified by its CAS number 1283720-15-9, is a chemical compound characterized by its complex structure, which includes a piperidine ring and a trifluoroacetyl group. This compound typically exhibits properties associated with both its piperidine moiety and the presence of the trifluoroacetyl functional group, which can influence its reactivity and solubility. The trifluoroacetyl group is known for its electron-withdrawing properties, which can enhance the acidity of adjacent protons and affect the compound's overall stability. Additionally, the presence of the tert-butyl group (1,1-dimethylethyl) contributes to steric hindrance, potentially impacting the compound's interactions with other molecules. Such characteristics make it of interest in various fields, including medicinal chemistry and materials science, where it may serve as a building block for more complex molecules or as a potential pharmaceutical agent. Its specific applications and behavior would depend on further studies and context within chemical reactions or formulations.

Formula: C₁₂H₁₈F₃NO₃

InChI: InChI=1S/C12H18F3NO3/c1-11(2,3)19-10(18)16-7-5-4-6-8(16)9(17)12(13,14)15/h8H,4-7H2,1-3H3

InChI key: InChIKey=CRQIPQULLHTBII-UHFFFAOYSA-N

SMILES: C(C(F)(F)F)(=O)C1N(C(OC(C)(C)C)=O)CCCC1

Synonyms:

• 1,1-Dimethylethyl 2-(2,2,2-trifluoroacetyl)-1-piperidinecarboxylate
• 1-Piperidinecarboxylic acid, 2-(2,2,2-trifluoroacetyl)-, 1,1-dimethylethyl ester