CAS 128373-23-9

5-Phenyl-2-furancarboxamide

Description:

5-Phenyl-2-furancarboxamide is an organic compound characterized by its unique structure, which includes a furan ring and an amide functional group. The furan ring contributes to its aromatic properties, while the phenyl group enhances its stability and potential reactivity. This compound typically exhibits moderate solubility in organic solvents, reflecting its polar and non-polar characteristics due to the presence of both the furan and phenyl groups. It may display biological activity, making it of interest in pharmaceutical research, particularly in the development of new therapeutic agents. The amide functional group can participate in hydrogen bonding, influencing its interactions with other molecules. Additionally, 5-Phenyl-2-furancarboxamide may undergo various chemical reactions, such as acylation or substitution, which can be exploited in synthetic chemistry. Its specific properties, such as melting point, boiling point, and spectral characteristics, would require empirical measurement or reference to literature for precise values. Overall, this compound represents a versatile structure with potential applications in medicinal chemistry and material science.

Formula: C₁₁H₉NO₂

InChI: InChI=1S/C11H9NO2/c12-11(13)10-7-6-9(14-10)8-4-2-1-3-5-8/h1-7H,(H2,12,13)

InChI key: InChIKey=ZNMIEYHOIRLLES-UHFFFAOYSA-N

SMILES: C(N)(=O)C=1OC(=CC1)C2=CC=CC=C2

Synonyms:

• 2-Furancarboxamide, 5-phenyl-
• 5-Phenyl-2-furancarboxamide