
CAS 128377-38-8
:4-(Iminomethyl)benzamide
Description:
4-(Iminomethyl)benzamide, with the CAS number 128377-38-8, is an organic compound characterized by the presence of an iminomethyl group attached to a benzamide structure. This compound features a benzene ring substituted with an amide functional group and an imine, which is indicative of its potential reactivity and applications in organic synthesis. The presence of the iminomethyl group suggests that it may exhibit properties such as hydrogen bonding and the ability to participate in various chemical reactions, including nucleophilic additions or condensation reactions. Its molecular structure contributes to its solubility in polar solvents, while its aromatic nature may influence its stability and interaction with other molecules. 4-(Iminomethyl)benzamide may be of interest in medicinal chemistry and materials science due to its potential biological activity and utility in the development of pharmaceuticals or as a building block in organic synthesis. As with many organic compounds, safety and handling precautions should be observed, as its specific toxicity and reactivity profiles would need to be evaluated in practical applications.
Formula:C8H8N2O
InChI:InChI=1S/C8H8N2O/c9-5-6-1-3-7(4-2-6)8(10)11/h1-5,9H,(H2,10,11)
InChI key:InChIKey=HTHYDAXLOIOBHQ-UHFFFAOYSA-N
SMILES:C(N)(=O)C1=CC=C(C=N)C=C1
Synonyms:- 4-(Iminomethyl)benzamide
- Benzamide, 4-(iminomethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
