CAS 128396-15-6
:schumanniofioside A
Description:
Schumanniofioside A, with the CAS number 128396-15-6, is a naturally occurring glycoside that has garnered interest due to its potential biological activities. This compound is derived from certain plant sources and is characterized by its complex molecular structure, which typically includes a sugar moiety linked to a non-sugar component. The presence of multiple functional groups in its structure contributes to its solubility in polar solvents and its reactivity in various chemical environments. Schumanniofioside A has been studied for its pharmacological properties, including potential antioxidant and anti-inflammatory effects, making it a subject of interest in medicinal chemistry. Additionally, its unique structural features may influence its interaction with biological targets, leading to various therapeutic applications. As with many natural products, the extraction and purification processes are crucial for obtaining this compound in a form suitable for research and potential use in pharmaceuticals. Further studies are necessary to fully elucidate its mechanisms of action and potential health benefits.
Formula:C16H18O9
InChI:InChI=1/C16H18O9/c1-6-2-8(19)12-9(23-6)3-7(18)4-10(12)24-16-15(22)14(21)13(20)11(5-17)25-16/h2-4,11,13-18,20-22H,5H2,1H3/t11-,13-,14+,15-,16-/m1/s1
Synonyms:- 2-Methyl-5,7-dihydroxychromone 5-O-beta-glycopyranoside
- 5-(beta-D-Glucopyranosyloxy)-7-hydroxy-2-methyl-4H-1-benzopyran-4-one
- 4H-1-Benzopyran-4-one, 5-(beta-D-glucopyranosyloxy)-7-hydroxy-2-methyl-
- 7-hydroxy-2-methyl-4-oxo-4H-chromen-5-yl beta-D-glucopyranoside
- Schumanniofioside A
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Schumanniofioside A
CAS:Schumanniofioside A is a naturally occurring saponin, which is derived from the plant *Schumannia kamassi*. This saponin is characterized by its unique glycosidic structure, contributing to its bioactivity. Saponins, including Schumanniofioside A, are known for their ability to modulate various biological pathways. The mode of action of Schumanniofioside A involves disrupting cellular membranes and interacting with cholesterol, which can lead to modulation of immune responses and potential cytotoxic effects on certain cancer cells.Formula:C16H18O9Purity:Min. 95%Molecular weight:354.31 g/mol
