CAS 128397-09-1
:Benzo[3,4]-18-norandrosta-3,5,15-triene-3(2'H)-carboxylicacid,3',4',5',6'-tetrahydro-3'-hydroxy-15-(hydroxymethyl)-3',4',9,14,17,17-hexamethyl-,(3b,3'a,4b,4'a,8a,9b,10a,13a,14b)-
Description:
Benzo[3,4]-18-norandrosta-3,5,15-triene-3(2'H)-carboxylic acid, 3',4',5',6'-tetrahydro-3'-hydroxy-15-(hydroxymethyl)-3',4',9,14,17,17-hexamethyl-, with CAS number 128397-09-1, is a synthetic steroid compound that belongs to the class of anabolic steroids. It features a complex polycyclic structure characterized by multiple methyl groups and hydroxyl functionalities, which contribute to its biological activity. The presence of a carboxylic acid group indicates potential for solubility in polar solvents and may influence its interaction with biological systems. This compound is often studied for its effects on muscle growth and performance enhancement, typical of anabolic steroids. Its structural modifications, such as the presence of the benzo group and various methyl and hydroxyl substituents, may affect its pharmacokinetics and pharmacodynamics. As with many anabolic steroids, it is essential to consider the legal and health implications associated with its use, as well as its potential for side effects.
Formula:C7H10O2
InChI:InChI=1S/C30H46O4/c1-18-10-13-30(24(32)33)15-14-26(4)20(23(30)29(18,7)34)8-9-22-27(26,5)12-11-21-25(2,3)16-19(17-31)28(21,22)6/h8,16,18,21-23,31,34H,9-15,17H2,1-7H3,(H,32,33)/t18-,21+,22+,23-,26-,27-,28+,29-,30+/m1/s1
InChI key:InChIKey=YFLYOZWZPSYMPX-DCLYBNOZSA-N
SMILES:C[C@]12C([C@]3([C@@](C(O)=O)(CC1)CC[C@@H](C)[C@@]3(C)O)[H])=CC[C@]4([C@@]2(C)CC[C@@]5([C@]4(C)C(CO)=CC5(C)C)[H])[H]
Synonyms:- (+)-Hyptadienic acid
- (3β,3′α,4β,4′α,8α,9β,10α,13α,14β)-3′,4′,5′,6′-Tetrahydro-3′-hydroxy-15-(hydroxymethyl)-3′,4′,9,14,17,17-hexamethylbenzo[3,4]-18-norandrosta-3,5,15-triene-3(2′H)-carboxylic acid
- A(1)-Norursa-2,12-dien-28-oic acid, 19-hydroxy-2-(hydroxymethyl)-
- A(1)-Norursa-2,12-dien-28-oicacid, 19-hydroxy-2-(hydroxymethyl)-
- Benzo[3,4]-18-norandrosta-3,5,15-triene-3(2′H)-carboxylic acid, 3′,4′,5′,6′-tetrahydro-3′-hydroxy-15-(hydroxymethyl)-3′,4′,9,14,17,17-hexamethyl-, (3β,3′α,4β,4′α,8α,9β,10α,13α,14β)-
- Coleonolic acid
- Benzo[3,4]-18-norandrosta-3,5,15-triene-3(2'H)-carboxylicacid,3',4',5',6'-tetrahydro-3'-hydroxy-15-(hydroxymethyl)-3',4',9,14,17,17-hexamethyl-,(3b,3'a,4b,4'a,8a,9b,10a,13a,14b)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Hyptadienic acid
CAS:Hyptadienic acid: cytotoxic to HepG2 cells, anti-inflammatory, inhibits mouse tumor promotion by DMBA/TPA.
Formula:C30H46O4Purity:98%Color and Shape:SolidMolecular weight:470.68Hyptadienic acid
CAS:Controlled ProductHyptadienic acid is a specialized fatty acid, which is derived from the essential oils found in rosemary, a well-known herb in the Lamiaceae family. This compound is notable for its dual mechanism of action, exhibiting both antioxidant and anti-inflammatory properties. As an antioxidant, hyptadienic acid counteracts oxidative stress by neutralizing free radicals, thereby preventing cellular damage. Its anti-inflammatory effects are mediated through the inhibition of key pro-inflammatory mediators, which might be involved in various signaling pathways.Formula:C30H46O4Purity:Min. 95%Molecular weight:470.7 g/mol



