CAS 1284163-34-3

Methyl 4-[[(1,1-dimethylethoxy)carbonyl]amino]-1H-indole-3-carboxylate

Description:

Methyl 4-[[(1,1-dimethylethoxy)carbonyl]amino]-1H-indole-3-carboxylate is a chemical compound characterized by its complex structure, which includes an indole ring, a carboxylate group, and an amine functionality. This compound features a methyl ester group, which enhances its solubility in organic solvents and may influence its reactivity. The presence of the 1,1-dimethylethoxycarbonyl group suggests that it may exhibit protective group characteristics, commonly used in organic synthesis to shield reactive amine sites. The indole moiety is known for its biological significance, often found in various natural products and pharmaceuticals, contributing to the compound's potential biological activity. Additionally, the compound's molecular structure may impart specific physicochemical properties, such as melting point, boiling point, and solubility, which are essential for its application in research and development. Overall, this compound's unique features make it a subject of interest in medicinal chemistry and synthetic organic chemistry.

Formula: C₁₅H₁₈N₂O₄

InChI: InChI=1S/C15H18N2O4/c1-15(2,3)21-14(19)17-11-7-5-6-10-12(11)9(8-16-10)13(18)20-4/h5-8,16H,1-4H3,(H,17,19)

InChI key: InChIKey=GQMKLFNRJSLGHX-UHFFFAOYSA-N

SMILES: C(OC)(=O)C=1C2=C(NC(OC(C)(C)C)=O)C=CC=C2NC1

Synonyms:

• 1H-Indole-3-carboxylic acid, 4-[[(1,1-dimethylethoxy)carbonyl]amino]-, methyl ester
• Methyl 4-[[(1,1-dimethylethoxy)carbonyl]amino]-1H-indole-3-carboxylate