CAS 1284225-61-1

2,3-Dihydro-2-oxo-1,3-bis(phenylmethyl)-1H-imidazole-4,5-dicarboxylic acid

Description:

2,3-Dihydro-2-oxo-1,3-bis(phenylmethyl)-1H-imidazole-4,5-dicarboxylic acid is a chemical compound characterized by its imidazole ring structure, which is a five-membered heterocyclic compound containing nitrogen atoms. This substance features two carboxylic acid groups, contributing to its acidity and potential for forming salts or esters. The presence of phenylmethyl groups enhances its lipophilicity, which may influence its solubility and biological activity. The compound is likely to exhibit various chemical reactivity patterns typical of imidazole derivatives, including potential coordination with metal ions and participation in nucleophilic substitution reactions. Its unique structure may confer specific pharmacological properties, making it of interest in medicinal chemistry. Additionally, the compound's stability, melting point, and solubility characteristics would depend on the specific conditions and solvents used. Overall, this compound's structural features suggest potential applications in pharmaceuticals or as a building block in organic synthesis.

Formula: C₁₉H₁₆N₂O₅

InChI: InChI=1S/C19H16N2O5/c22-17(23)15-16(18(24)25)21(12-14-9-5-2-6-10-14)19(26)20(15)11-13-7-3-1-4-8-13/h1-10H,11-12H2,(H,22,23)(H,24,25)

InChI key: InChIKey=SABUYEGPZROXGT-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(C(O)=O)N(CC2=CC=CC=C2)C(=O)N1CC3=CC=CC=C3

Synonyms:

• 2,3-Dihydro-2-oxo-1,3-bis(phenylmethyl)-1H-imidazole-4,5-dicarboxylic acid
• 1H-Imidazole-4,5-dicarboxylic acid, 2,3-dihydro-2-oxo-1,3-bis(phenylmethyl)-