
CAS 1284227-57-1
:4-Bromo-3-methyl[1,1′-biphenyl]-2-carbonitrile
Description:
4-Bromo-3-methyl[1,1′-biphenyl]-2-carbonitrile is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a bromine atom at the 4-position and a methyl group at the 3-position on one of the phenyl rings contributes to its unique chemical properties. Additionally, the compound features a cyano group (-C≡N) at the 2-position, which enhances its reactivity and polarity. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its physical properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and purity of the sample. As with many halogenated compounds, it may exhibit specific environmental and health considerations, necessitating careful handling and disposal. Overall, 4-Bromo-3-methyl[1,1′-biphenyl]-2-carbonitrile is a versatile compound with applications in various fields of chemistry.
Formula:C14H10BrN
InChI:InChI=1S/C14H10BrN/c1-10-13(9-16)12(7-8-14(10)15)11-5-3-2-4-6-11/h2-8H,1H3
InChI key:InChIKey=JGVFSTYELULBTJ-UHFFFAOYSA-N
SMILES:C(#N)C1=C(C=CC(Br)=C1C)C2=CC=CC=C2
Synonyms:- [1,1′-Biphenyl]-2-carbonitrile, 4-bromo-3-methyl-
- 4-Bromo-3-methyl[1,1′-biphenyl]-2-carbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
