CAS 1284246-82-7

1,1-Dimethylethyl N-[2-[(2-bromoacetyl)(2-methylpropyl)amino]ethyl]carbamate

Description:

1,1-Dimethylethyl N-[2-[(2-bromoacetyl)(2-methylpropyl)amino]ethyl]carbamate, identified by its CAS number 1284246-82-7, is a synthetic organic compound characterized by its complex structure, which includes a carbamate functional group and a bromoacetyl moiety. This compound typically exhibits properties associated with both amines and carbamates, such as potential reactivity due to the presence of the bromoacetyl group, which can participate in nucleophilic substitution reactions. The presence of the dimethyl group contributes to steric hindrance, potentially influencing its reactivity and solubility in various solvents. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests it could interact with biological systems, possibly serving as a precursor or intermediate in the synthesis of more complex molecules. As with many synthetic compounds, safety and handling precautions are essential due to potential toxicity or reactivity, particularly concerning the bromoacetyl group.

Formula: C₁₃H₂₅BrN₂O₃

InChI: InChI=1S/C13H25BrN2O3/c1-10(2)9-16(11(17)8-14)7-6-15-12(18)19-13(3,4)5/h10H,6-9H2,1-5H3,(H,15,18)

InChI key: InChIKey=ZWNNPJONWVTCJZ-UHFFFAOYSA-N

SMILES: N(C(CBr)=O)(CC(C)C)CCNC(OC(C)(C)C)=O

Synonyms:

• 1,1-Dimethylethyl N-[2-[(2-bromoacetyl)(2-methylpropyl)amino]ethyl]carbamate
• Carbamic acid, N-[2-[(2-bromoacetyl)(2-methylpropyl)amino]ethyl]-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl [2-[(bromoacetyl)(2-methylpropyl)amino]ethyl]carbamate