CymitQuimica logo

CAS 1284250-10-7

:

(trans-3-aminocyclobutyl)methanol hydrochloride

Description:
(trans-3-Aminocyclobutyl)methanol hydrochloride is a chemical compound characterized by its unique cyclic structure and functional groups. It features a cyclobutane ring with an amino group and a hydroxymethyl group attached, contributing to its potential biological activity. The hydrochloride form indicates that the compound is a salt, which enhances its solubility in water and may influence its pharmacokinetic properties. This compound is likely to exhibit properties typical of amines and alcohols, such as hydrogen bonding capabilities, which can affect its reactivity and interactions with other molecules. The presence of the amino group suggests potential for biological activity, possibly as a neurotransmitter or in other physiological processes. Its specific stereochemistry, indicated by the "trans" designation, may also play a crucial role in its biological interactions and overall stability. As with many organic compounds, safety data and handling precautions should be considered, especially in laboratory settings. Further research may be necessary to fully elucidate its properties and potential applications in medicinal chemistry or other fields.
Formula:C5H12ClNO
InChI:InChI=1S/C5H11NO.ClH/c6-5-1-4(2-5)3-7;/h4-5,7H,1-3,6H2;1H
InChI key:NGVZDZFNCCGDGQ-UHFFFAOYSA-N
SMILES:C1C(CC1N)CO.Cl
Found 4 products.