CAS 128426-47-1
:1-allyl-2-chloro-4-fluoro-benzene
Description:
1-Allyl-2-chloro-4-fluoro-benzene, with the CAS number 128426-47-1, is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with an allyl group, a chlorine atom, and a fluorine atom. The presence of the allyl group introduces a vinyl-like reactivity, making it useful in various chemical reactions, particularly in organic synthesis. The chlorine and fluorine substituents contribute to the compound's reactivity and influence its physical properties, such as polarity and boiling point. This compound is typically a colorless to pale yellow liquid, exhibiting moderate volatility. Its unique combination of functional groups allows for potential applications in pharmaceuticals, agrochemicals, and materials science. Additionally, the presence of halogens can enhance the compound's stability and reactivity in electrophilic aromatic substitution reactions. Safety data should be consulted for handling, as halogenated compounds can pose health and environmental risks. Overall, 1-allyl-2-chloro-4-fluoro-benzene is a versatile compound with significant implications in synthetic organic chemistry.
Formula:C9H8ClF
InChI:InChI=1/C9H8ClF/c1-2-3-7-4-5-8(11)6-9(7)10/h2,4-6H,1,3H2
SMILES:C=CCc1ccc(cc1Cl)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
