CAS 128426-86-8
:3-(Difluoromethoxy)-2,4,5-trifluorobenzoic acid
Description:
3-(Difluoromethoxy)-2,4,5-trifluorobenzoic acid is a fluorinated aromatic compound characterized by the presence of multiple fluorine substituents and a carboxylic acid functional group. The molecular structure features a benzoic acid core, which is substituted at the 3-position with a difluoromethoxy group and at the 2, 4, and 5 positions with trifluoromethyl groups. This unique arrangement contributes to its chemical properties, including increased lipophilicity and potential reactivity due to the electron-withdrawing nature of the fluorine atoms. The compound is likely to exhibit high thermal stability and resistance to oxidation, making it suitable for various applications in pharmaceuticals and agrochemicals. Additionally, the presence of multiple fluorine atoms can enhance its biological activity and influence its interaction with biological systems. As with many fluorinated compounds, it may also exhibit unique solubility characteristics in organic solvents. Safety and handling precautions should be observed due to the potential toxicity associated with fluorinated compounds.
Formula:C8H3F5O3
InChI:InChI=1/C8H3F5O3/c9-3-1-2(7(14)15)4(10)6(5(3)11)16-8(12)13/h1,8H,(H,14,15)
SMILES:c1c(c(c(c(c1F)F)OC(F)F)F)C(=O)O
Synonyms:- 3-Difluoromethoxy-2,4,5-triflu
- 3-(Difluoromethyl)-2,4,5-Trifluorobenzoic Acid
- 3-Difluoro Methoxy-2,4,5-Trifluorobenzoic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
3-(Difluoromethoxy)-2,4,5-trifluorobenzoic acid
CAS:<p>3-(Difluoromethoxy)-2,4,5-trifluorobenzoic acid is an antibacterial drug that belongs to the class of fluoroquinolones. It inhibits bacterial growth by binding to DNA gyrase and topoisomerase IV enzymes in bacteria. 3-(Difluoromethoxy)-2,4,5-trifluorobenzoic acid has been shown to be active against a wide variety of bacteria and is used as a treatment for urinary tract infections and skin infections. 3-(Difluoromethoxy)-2,4,5-trifluorobenzoic acid can also be used in combination with other antibiotics such as tetrabutyl ammonium chloride to enhance their effects.</p>Formula:C8H3F5O3Purity:Min. 95%Color and Shape:SolidMolecular weight:242.1 g/mol
