CAS 128446-36-6
:β-Cyclodextrin, methyl ethers
Description:
β-Cyclodextrin methyl ethers are derivatives of β-cyclodextrin, a cyclic oligosaccharide composed of seven glucose units linked by α-1,4-glycosidic bonds. The methylation of β-cyclodextrin enhances its solubility in organic solvents and improves its ability to form inclusion complexes with various guest molecules, making it valuable in pharmaceutical and food applications. These ethers typically exhibit a hydrophilic exterior and a hydrophobic cavity, allowing them to encapsulate lipophilic compounds, thereby enhancing their stability and bioavailability. The modification also influences their physicochemical properties, such as molecular weight and viscosity. β-Cyclodextrin methyl ethers are generally recognized as safe (GRAS) for use in food and pharmaceuticals, and they can facilitate controlled release of active ingredients. Additionally, they may exhibit varying degrees of toxicity depending on the degree of substitution and the specific formulation. Overall, these compounds are significant in enhancing the delivery and efficacy of various bioactive substances.
Formula:Unspecified
InChI:InChI=1/C56H98O35/c1-64-15-22-36-29(57)43(71-8)50(78-22)86-37-23(16-65-2)80-52(45(73-10)30(37)58)88-39-25(18-67-4)82-54(47(75-12)32(39)60)90-41-27(20-69-6)84-56(49(77-14)34(41)62)91-42-28(21-70-7)83-55(48(76-13)35(42)63)89-40-26(19-68-5)81-53(46(74-11)33(40)61)87-38-24(17-66-3)79-51(85-36)44(72-9)31(38)59/h22-63H,15-21H2,1-14H3
SMILES:COCC1C2C(C(C(O1)OC1C(COC)OC(C(C1O)OC)OC1C(COC)OC(C(C1O)OC)OC1C(COC)OC(C(C1O)OC)OC1C(COC)OC(C(C1O)OC)OC1C(COC)OC(C(C1O)OC)OC1C(COC)OC(C(C1O)OC)O2)OC)O
Synonyms:- 37,39,41,43,45,47,49-Heptamethoxy-5,10,15,20,25,30,35-Heptakis(Methoxymethyl)-2,4,7,9,12,14,17,19,22,24,27,29,32,34-Tetradecaoxaoctacyclo[31.2.2.2~3,6~.2~8,11~.2~13,16~.2~18,21~.2~23,26~.2~28,31~]Nonatetracontane-36,38,40,42,44,46,48-Heptol (Non-Preferred Name)
- Beta-Cyclodextrin Methyl Ethers
- Methyl--cyclodextrin
- Methyl-beta-cyclodextrine
- methyl-B-cyclodextrin cell culture*tested
- β-Cyclodextrin, methyl ethers
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 12 products.
Methyl-β-cyclodextrin (mixture of several Methylated)
CAS:Color and Shape:White to Light yellow to Light red powder to crystalMethyl-β-cyclodextrin
CAS:<p>Cavity size is the major determinant as to which cyclodextrin is used in complexation. The cavity diameter of -cyclodextrins or -glucopyranose unit compounds is well-suited for use with molecules the size of hormones, vitamins and many compounds frequently used in tissue and cell culture application</p>Color and Shape:Powder, White to off-whiteβ-Cyclodextrin, methyl ethers
CAS:Formula:C10H21O5Purity:99%Color and Shape:SolidMolecular weight:221.2707Methyl-β-cyclodextrin (DS~9)
CAS:<p>Methyl-β-cyclodextrin (DS~9)</p>Purity:98%Molecular weight:1303.3g/molMethyl-β-cyclodextrin
CAS:<p>Methyl-β-cyclodextrin (Methyl-beta-cyclodextrin) is a macrocyclic compound used as a solubilizer for hydrophobic compounds in biological experiments.</p>Formula:C54H94O35Purity:99.45% - ≥98%Color and Shape:White To Off-PowderMolecular weight:1310(Average)Methyl-β-cyclodextrin (DS~12)
CAS:<p>Methyl-β-cyclodextrin (DS~12)</p>Color and Shape:White SolidMolecular weight:1,303.30g/molMethyl-β-cyclodextrin (Mixture of Methylated)
CAS:Controlled ProductFormula:C8H7FO2Color and Shape:NeatMethyl-b-cyclodextrin - 3 to 9 degree of substitution
CAS:<p>This beta-cyclodextrin (β-CD) derivative is a functionalized cyclic oligosaccharide composed of seven glucose units, characterized by a hydrophilic exterior and a lipophilic cavity (bigger than α-CD and smaller than γ-CDs), which allows it to encapsulate various guest molecules. This structural feature facilitates its use in multiple applications, including pharmaceuticals, food enhancement, and cosmetics. In the pharmaceutical industry, it enhances the solubility and stability of poorly water-soluble drugs, improving their bioavailability and efficacy while also masking unpleasant tastes. The food sector utilizes it as a stabilizer for flavors, colors, and nutrients, extending shelf life by protecting sensitive ingredients from degradation. In cosmetics, it serves as a complexing agent for fragrances and active components, ensuring their stability and controlled release. Its use expands to many other fields, including nanotechnology for drug delivery systems, environmental remediation for extracting organic pollutants, textiles for slow-release fragrances, and analytical chemistry for chiral separation.</p>Formula:C56H98O35Color and Shape:White PowderMolecular weight:1331.36Methyl-β-cyclodextrin - 7 to 14 degree of substitution
CAS:<p>This beta-cyclodextrin (β-CD) derivative is a functionalized cyclic oligosaccharide composed of seven glucose units, characterized by a hydrophilic exterior and a lipophilic cavity (bigger than α-CD and smaller than γ-CDs), which allows it to encapsulate various guest molecules. This structural feature facilitates its use in multiple applications, including pharmaceuticals, food enhancement, and cosmetics. In the pharmaceutical industry, it enhances the solubility and stability of poorly water-soluble drugs, improving their bioavailability and efficacy while also masking unpleasant tastes. The food sector utilizes it as a stabilizer for flavors, colors, and nutrients, extending shelf life by protecting sensitive ingredients from degradation. In cosmetics, it serves as a complexing agent for fragrances and active components, ensuring their stability and controlled release. Its use expands to many other fields, including nanotechnology for drug delivery systems, environmental remediation for extracting organic pollutants, textiles for slow-release fragrances, and analytical chemistry for chiral separation.</p>Formula:C56H98O35Color and Shape:PowderMolecular weight:1,331.36 g/mol
