CAS 128450-32-8
:methyl 3-methoxy-4-methyl-2-nitro-benzoate
Description:
Methyl 3-methoxy-4-methyl-2-nitrobenzoate, with the CAS number 128450-32-8, is an organic compound belonging to the class of benzoates. It features a benzoic acid derivative structure, characterized by the presence of a nitro group, methoxy group, and methyl group on the aromatic ring. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents such as ethanol and acetone, but has limited solubility in water due to its hydrophobic aromatic structure. The presence of the nitro group contributes to its potential reactivity, making it a candidate for various chemical transformations. Methyl 3-methoxy-4-methyl-2-nitrobenzoate may be utilized in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Its specific properties, such as melting point, boiling point, and spectral characteristics, can vary based on purity and environmental conditions. As with many nitro compounds, it should be handled with care due to potential toxicity and environmental impact.
Formula:C10H11NO5
InChI:InChI=1/C10H11NO5/c1-6-4-5-7(10(12)16-3)8(11(13)14)9(6)15-2/h4-5H,1-3H3
Synonyms:- benzoic acid, 3-methoxy-4-methyl-2-nitro-, methyl ester
- Methyl 3-methoxy-4-methyl-2-nitrobenzoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
