CAS 128464-85-7
:3-bromo-5-tert-butyl-4,5-dihydroisoxazole
Description:
3-Bromo-5-tert-butyl-4,5-dihydroisoxazole is a heterocyclic organic compound characterized by the presence of a five-membered isoxazole ring, which contains both nitrogen and oxygen atoms. The compound features a bromine substituent at the 3-position and a tert-butyl group at the 5-position, contributing to its unique chemical properties. The presence of the bromine atom can enhance the compound's reactivity, making it useful in various synthetic applications. The tert-butyl group, known for its steric bulk, can influence the compound's solubility and stability. This compound may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry. Its structure allows for potential interactions with biological targets, which could be explored in drug development. Additionally, the dihydroisoxazole framework can participate in various chemical reactions, including nucleophilic substitutions and cycloadditions, further expanding its utility in organic synthesis. Overall, 3-bromo-5-tert-butyl-4,5-dihydroisoxazole is a versatile compound with significant implications in both research and application.
Formula:C7H12BrNO
InChI:InChI=1/C7H12BrNO/c1-7(2,3)5-4-6(8)9-10-5/h5H,4H2,1-3H3
SMILES:CC(C)(C)C1CC(=NO1)Br
Synonyms:- 3-Bromo-5-tert-butyl-4,5-dihydro-1,2-oxazole
- Isoxazole, 3-bromo-5-(1,1-dimethylethyl)-4,5-dihydro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-Bromo-5-tert-butyl-4,5-dihydroisoxazole
CAS:Controlled ProductFormula:C7H12BrNOColor and Shape:NeatMolecular weight:206.08
