
CAS 128470-17-7
:[5,8-Bis[(carboxy-κO)methyl]-11-[2-(methylamino)-2-(oxo-κO)ethyl]-3-(oxo-κO)-2,5,8,11-tetraazatridecan-13-oato(3-)-κN5,κN8,κN11,κO]dysprosium
Description:
The chemical substance known as "[5,8-Bis[(carboxy-κO)methyl]-11-[2-(methylamino)-2-(oxo-κO)ethyl]-3-(oxo-κO)-2,5,8,11-tetraazatridecan-13-oato(3-)-κN5,κN8,κN11,κO]dysprosium" with CAS number 128470-17-7 is a complex coordination compound featuring dysprosium, a lanthanide element. This compound is characterized by its intricate structure, which includes multiple functional groups such as carboxymethyl and methylamino groups, contributing to its solubility and reactivity. The presence of oxo groups indicates potential for coordination with metal ions, enhancing its stability and biological activity. Dysprosium, being a rare earth element, imparts unique magnetic and optical properties to the compound, making it of interest in various applications, including materials science and biomedicine. The tetraazatridecan backbone suggests a polyamine structure, which may facilitate interactions with biological systems. Overall, this compound exemplifies the complexity and versatility of coordination chemistry, particularly in the context of lanthanide-based materials.
Formula:C16H26DyN5O8
InChI:InChI=1S/C16H29N5O8.Dy/c1-17-12(22)7-20(10-15(26)27)5-3-19(9-14(24)25)4-6-21(11-16(28)29)8-13(23)18-2;/h3-11H2,1-2H3,(H,17,22)(H,18,23)(H,24,25)(H,26,27)(H,28,29);/q;+3/p-3
InChI key:InChIKey=ABWHOEHSTSEVRD-UHFFFAOYSA-K
SMILES:N(C)C1=O[Dy+3]234567[N](CC[N]2(C1)CC(=O)[O-]3)(CC[N]4(CC(NC)=O5)CC(=O)[O-]6)CC(=O)[O-]7
Synonyms:- Dysprosium, [5,8-bis(carboxymethyl)-11-[2-(methylamino)-2-oxoethyl]-3-oxo-2,5,8,11-tetraazatridecan-13-oato(3-)]-
- Dysprosium, [5,8-bis[(carboxy-κO)methyl]-11-[2-(methylamino)-2-(oxo-κO)ethyl]-3-(oxo-κO)-2,5,8,11-tetraazatridecan-13-oato(3-)-κN5,κN8,κN11,κO]-
- S 043 Injection
- 2,5,8,11-Tetraazatridecan-13-oic acid, 5,8-bis(carboxymethyl)-11-[2-(methylamino)-2-oxoethyl]-3-oxo-, dysprosium complex
- [5,8-Bis[(carboxy-κO)methyl]-11-[2-(methylamino)-2-(oxo-κO)ethyl]-3-(oxo-κO)-2,5,8,11-tetraazatridecan-13-oato(3-)-κN5,κN8,κN11,κO]dysprosium
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Sprodiamide
CAS:<p>Sprodiamide is a magnetic susceptibility-based MRI contrast agent.</p>Formula:C16H26DyN5O8Color and Shape:SolidMolecular weight:578.91
