CAS 128495-45-4
:4-FLUORO-3-METHOXYBENZYL ALCOHOL
Description:
4-Fluoro-3-methoxybenzyl alcohol is an organic compound characterized by the presence of a fluorine atom and a methoxy group attached to a benzyl alcohol structure. The molecular formula typically includes a benzene ring substituted with a fluorine atom at the para position and a methoxy group at the meta position relative to the hydroxyl group. This compound is likely to exhibit moderate polarity due to the hydroxyl group, which can engage in hydrogen bonding, enhancing its solubility in polar solvents. The presence of the fluorine atom may influence its reactivity and biological activity, potentially making it a candidate for various applications in medicinal chemistry and material science. Additionally, the methoxy group can affect the electronic properties of the molecule, possibly altering its interaction with biological targets. As with many organic compounds, safety and handling precautions should be observed, as it may pose risks depending on concentration and exposure routes.
Formula:C8H9FO2
InChI:InChI=1/C8H9FO2/c1-11-8-4-6(5-10)2-3-7(8)9/h2-4,10H,5H2,1H3
SMILES:COc1cc(ccc1F)CO
Synonyms:- (4-Fluoro-3-Methoxyphenyl)Methanol
- Rarechem Al Bd 0389
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Benzenemethanol, 4-fluoro-3-methoxy-
CAS:Formula:C8H9FO2Purity:98%Color and Shape:SolidMolecular weight:156.15434-Fluoro-3-methoxybenzyl alcohol
CAS:4-Fluoro-3-methoxybenzyl alcoholFormula:C8H9FO2Purity:98%Color and Shape: white crystalline solidMolecular weight:156.15g/mol4-Fluoro-3-methoxybenzyl alcohol
CAS:4-Fluoro-3-methoxybenzyl alcohol is a fluorinated alcohol that is synthesized by the asymmetric addition of bromide ion to an alkylated enolate. This compound is used in organic synthesis as a building block for the preparation of other biologically active molecules. 4-Fluoro-3-methoxybenzyl alcohol can be used to synthesize l-tyrosine and glycine, which are amino acids that are important for protein synthesis. It also can be used in the production of propanoic acid, which is an important precursor for the industrial production of polymers such as polypropylene and polyethylene. 4-Fluoro-3-methoxybenzyl alcohol is not active against bacteria due to its lack of antibacterial properties.
Formula:C8H9FO2Purity:Min. 95%Color and Shape:PowderMolecular weight:156.15 g/mol4-Fluoro-3-methoxybenzyl alcohol
CAS:Formula:C8H9FO2Purity:98%Color and Shape:Solid, White to yellow crystalline powderMolecular weight:156.156



