CAS 128501-82-6
:3-[(Diethylamino)methyl]-4-methoxybenzaldehyde
Description:
3-[(Diethylamino)methyl]-4-methoxybenzaldehyde, with the CAS number 128501-82-6, is an organic compound characterized by its aromatic structure and functional groups. It features a methoxy group (-OCH3) and an aldehyde group (-CHO) attached to a benzene ring, which contributes to its reactivity and potential applications in organic synthesis. The presence of the diethylamino group enhances its nucleophilicity and can influence its solubility in various solvents. This compound is typically a yellow to brown solid at room temperature and may exhibit moderate to high stability under standard conditions. Its molecular structure allows for potential interactions in biological systems, making it of interest in medicinal chemistry. Additionally, due to the presence of both electron-donating and electron-withdrawing groups, it may display unique electronic properties, which can be exploited in dye synthesis or as a building block in the development of pharmaceuticals. Proper handling and storage are essential, as with many organic compounds, to ensure safety and maintain integrity.
Formula:C13H19NO2
InChI:InChI=1S/C13H19NO2/c1-4-14(5-2)9-12-8-11(10-15)6-7-13(12)16-3/h6-8,10H,4-5,9H2,1-3H3
InChI key:InChIKey=NWINHGROAQWCPR-UHFFFAOYSA-N
SMILES:C(N(CC)CC)C1=C(OC)C=CC(C=O)=C1
Synonyms:- Benzaldehyde, 3-[(diethylamino)methyl]-4-methoxy-
- 3-[(Diethylamino)methyl]-4-methoxybenzaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
