CymitQuimica logo

CAS 128501-84-8

:

4-methoxy-3-(pyrrolidin-1-ylmethyl)benzaldehyde

Description:
4-Methoxy-3-(pyrrolidin-1-ylmethyl)benzaldehyde is an organic compound characterized by its aromatic structure, which includes a methoxy group and a pyrrolidine moiety. The presence of the methoxy group enhances its solubility in organic solvents and can influence its reactivity and interaction with biological systems. The benzaldehyde functional group contributes to its potential as a precursor in various synthetic pathways, particularly in the synthesis of more complex organic molecules. The pyrrolidine ring introduces a cyclic amine structure, which can impart unique properties such as increased lipophilicity and the ability to participate in hydrogen bonding. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its specific properties, such as melting point, boiling point, and spectral characteristics, would typically be determined through experimental methods. Overall, 4-methoxy-3-(pyrrolidin-1-ylmethyl)benzaldehyde is a versatile compound with potential applications in various fields, including pharmaceuticals and organic synthesis.
Formula:C13H17NO2
InChI:InChI=1/C13H17NO2/c1-16-13-5-4-11(10-15)8-12(13)9-14-6-2-3-7-14/h4-5,8,10H,2-3,6-7,9H2,1H3
SMILES:COc1ccc(cc1CN1CCCC1)C=O
Synonyms:
  • Benzaldehyde, 4-methoxy-3-(1-pyrrolidinylmethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.