CymitQuimica logo

CAS 128510-88-3

:

(R)-tert-Butyl 2-(tosyloxymethyl)pyrrolidine-1-carboxylate

Description:
(R)-tert-Butyl 2-(tosyloxymethyl)pyrrolidine-1-carboxylate is a chiral compound characterized by its pyrrolidine ring structure, which contributes to its potential biological activity. The presence of the tert-butyl group enhances its lipophilicity, making it more soluble in organic solvents, while the tosyl group serves as a good leaving group in nucleophilic substitution reactions. This compound is typically used in organic synthesis, particularly in the preparation of more complex molecules due to its ability to undergo various transformations. Its stereochemistry, indicated by the (R) configuration, is crucial for its reactivity and interaction with biological targets. The carboxylate functional group is also significant, as it can participate in various chemical reactions, including esterification and amidation. Overall, this compound's unique structural features make it a valuable intermediate in synthetic organic chemistry and medicinal chemistry applications.
Formula:C17H25NO5S
InChI:InChI=1/C17H25NO5S/c1-13-7-9-15(10-8-13)24(20,21)22-12-14-6-5-11-18(14)16(19)23-17(2,3)4/h7-10,14H,5-6,11-12H2,1-4H3
SMILES:Cc1ccc(cc1)S(=O)(=O)OCC1CCCN1C(=O)OC(C)(C)C
Synonyms:
  • 1-pyrrolidinecarboxylic acid, 2-[[[(4-methylphenyl)sulfonyl]oxy]methyl]-, 1,1-dimethylethyl ester, (2R)-
  • tert-butyl (2R)-2-({[(4-methylphenyl)sulfonyl]oxy}methyl)pyrrolidine-1-carboxylate
  • Tert-Butyl 2-({[(4-Methylphenyl)Sulfonyl]Oxy}Methyl)Pyrrolidine-1-Carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.