CAS 128537-44-0
:4-CHLORO-1-METHYL-3-(2-METHYLPROPYL)-1H-PYRAZOLE-5-CARBOXYLIC ACID ETHYL ESTER
Description:
4-Chloro-1-methyl-3-(2-methylpropyl)-1H-pyrazole-5-carboxylic acid ethyl ester, with the CAS number 128537-44-0, is a chemical compound characterized by its pyrazole core structure, which is a five-membered ring containing two nitrogen atoms. This compound features a chloro substituent at the 4-position and an ethyl ester functional group, contributing to its reactivity and solubility properties. The presence of the 2-methylpropyl group at the 3-position adds to its steric bulk, potentially influencing its biological activity and interactions. Typically, compounds of this nature may exhibit various pharmacological properties, making them of interest in medicinal chemistry. The ethyl ester moiety suggests that it may undergo hydrolysis to yield the corresponding carboxylic acid, which can further participate in various chemical reactions. Overall, the unique combination of functional groups and structural features makes this compound a subject of interest for further research in both synthetic and applied chemistry contexts.
Formula:C11H17ClN2O2
InChI:InChI=1/C11H17ClN2O2/c1-5-16-11(15)10-9(12)8(6-7(2)3)13-14(10)4/h7H,5-6H2,1-4H3
SMILES:CCOC(=O)c1c(c(CC(C)C)nn1C)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1H-Pyrazole-5-carboxylic acid, 4-chloro-1-methyl-3-(2-methylpropyl)-, ethyl ester
CAS:Formula:C11H17ClN2O2Molecular weight:244.7179
