CAS 128537-49-5
:4-Chloro-1-methyl-3-propyl-1H-pyrazole-5-carboxylic acid
Description:
4-Chloro-1-methyl-3-propyl-1H-pyrazole-5-carboxylic acid is a chemical compound characterized by its pyrazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features a chloro substituent at the 4-position and a carboxylic acid functional group at the 5-position, contributing to its acidic properties. The presence of a methyl group at the 1-position and a propyl group at the 3-position enhances its hydrophobic characteristics, influencing its solubility and reactivity. Typically, compounds of this nature are of interest in various fields, including pharmaceuticals and agrochemicals, due to their potential biological activity. The compound's molecular structure allows for various interactions, making it a candidate for further research in medicinal chemistry. Additionally, its CAS number, 128537-49-5, serves as a unique identifier for regulatory and safety information. Overall, this compound exemplifies the diverse chemistry associated with substituted pyrazoles, which can exhibit a range of biological and chemical properties.
Formula:C8H11ClN2O2
InChI:InChI=1/C8H11ClN2O2/c1-3-4-5-6(9)7(8(12)13)11(2)10-5/h3-4H2,1-2H3,(H,12,13)
InChI key:InChIKey=QCASQFHYPGEADG-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(Cl)C(CCC)=NN1C
Synonyms:- 1H-Pyrazole-5-carboxylic acid, 4-chloro-1-methyl-3-propyl-
- 4-Chloro-1-methyl-3-propyl-1H-pyrazole-5-carboxylic acid
- 4-chloro-2-Methyl-5-propylpyrazole-3-carboxylic Acid
- 4-chloro-2-methyl-5-propyl-3-pyrazolecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1H-Pyrazole-5-carboxylic acid, 4-chloro-1-methyl-3-propyl-
CAS:Formula:C8H11ClN2O2Molecular weight:202.6381
