
CAS 128542-54-1
:5-Iodo-2-naphthalenol
Description:
5-Iodo-2-naphthalenol is an organic compound characterized by its structure, which features a naphthalene ring substituted with an iodine atom and a hydroxyl group. This compound belongs to the class of halogenated phenols, which are known for their diverse chemical properties and potential applications in various fields, including pharmaceuticals and materials science. The presence of the iodine atom enhances its reactivity, making it a useful intermediate in organic synthesis. The hydroxyl group contributes to its solubility in polar solvents and can participate in hydrogen bonding, influencing its physical properties such as melting and boiling points. Additionally, 5-Iodo-2-naphthalenol may exhibit biological activity, which can be explored for potential therapeutic uses. Its chemical stability and reactivity can vary depending on the conditions, such as pH and temperature, making it an interesting subject for further research in both synthetic and medicinal chemistry.
Formula:C10H7IO
InChI:InChI=1S/C10H7IO/c11-10-3-1-2-7-6-8(12)4-5-9(7)10/h1-6,12H
InChI key:InChIKey=CVEDCNVEFNTPDU-UHFFFAOYSA-N
SMILES:IC=1C2=C(C=C(O)C=C2)C=CC1
Synonyms:- 5-Iodo-2-naphthalenol
- 2-Naphthalenol, 5-iodo-
- 1-Iodo-6-hydroxynaphthalene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.