CAS 128552-90-9
:2-Propenoic acid, 3-hydroxy-2-methyl-, (2E,6E,10E,14E)-3,7,11,15-tetramethyl-16-oxo-2,6,10,14-hexadecatetraenyl ester, (2Z)-
Description:
The chemical substance known as "2-Propenoic acid, 3-hydroxy-2-methyl-, (2E,6E,10E,14E)-3,7,11,15-tetramethyl-16-oxo-2,6,10,14-hexadecatetraenyl ester, (2Z)-" with CAS number 128552-90-9 is a complex organic compound characterized by its ester functional group and multiple double bonds within its structure. This compound features a propenoic acid backbone, indicating it has both unsaturation and functional groups that can participate in various chemical reactions. The presence of multiple methyl groups and a ketone functionality contributes to its hydrophobic nature and potential biological activity. Its stereochemistry, indicated by the (2E,6E,10E,14E) and (2Z) descriptors, suggests specific geometric configurations that can influence its reactivity and interactions with other molecules. Such compounds are often of interest in fields like organic synthesis, materials science, and biochemistry due to their potential applications in creating polymers, pharmaceuticals, or as intermediates in various chemical processes.
Formula:C24H36O4
InChI:InChI=1S/C24H36O4/c1-19(9-6-10-20(2)12-8-14-22(4)17-25)11-7-13-21(3)15-16-28-24(27)23(5)18-26/h10-11,14-15,17-18,26H,6-9,12-13,16H2,1-5H3/b19-11+,20-10+,21-15+,22-14+,23-18-
InChI key:InChIKey=JYQVRBSGMTVCKG-RLJLMZIGSA-N
SMILES:C(\COC(/C(=C\O)/C)=O)=C(/CC/C=C(/CC/C=C(/CC/C=C(/C=O)\C)\C)\C)\C
Synonyms:- 2-Propenoic acid, 3-hydroxy-2-methyl-, 3,7,11,15-tetramethyl-16-oxo-2,6,10,14-hexadecatetraenyl ester, (Z,E,E,E,E)-
- Cavipetin C
- 2-Propenoicacid, 3-hydroxy-2-methyl-,3,7,11,15-tetramethyl-16-oxo-2,6,10,14-hexadecatetraenyl ester, (Z,E,E,E,E)-
- 2-Propenoic acid, 3-hydroxy-2-methyl-, (2E,6E,10E,14E)-3,7,11,15-tetramethyl-16-oxo-2,6,10,14-hexadecatetraenyl ester, (2Z)-
- Cavipetin C
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Cavipetin C
CAS:Cavipetin C is a diterpene compound that can be isolated from B. cavipes. It exhibits antifungal activity and can inhibit the spore formation of Cladosporium cucumericum.Formula:C24H36O4Color and Shape:SolidMolecular weight:388.54
