
CAS 128554-52-9
:N,N′-[1,3-Phenylenebis(methylene)]bis[12-hydroxyoctadecanamide]
Description:
N,N′-[1,3-Phenylenebis(methylene)]bis[12-hydroxyoctadecanamide], with CAS number 128554-52-9, is a synthetic compound characterized by its amide functional groups and long hydrocarbon chains. This substance features a central phenylene group connected by methylene linkages to two identical 12-hydroxyoctadecanamide moieties, which contribute to its amphiphilic nature. The presence of hydroxyl groups enhances its solubility in polar solvents while the long hydrophobic hydrocarbon chains provide lipophilicity, making it suitable for applications in surfactants, emulsifiers, or as a stabilizing agent in formulations. Its structural characteristics suggest potential uses in the fields of materials science, pharmaceuticals, and cosmetics, where it may serve as a surfactant or a stabilizer due to its ability to interact with both hydrophilic and hydrophobic environments. Additionally, the compound's unique structure may impart specific biological activities, warranting further investigation into its potential applications in drug delivery or as a bioactive agent.
Formula:C44H80N2O4
InChI:InChI=1S/C44H80N2O4/c1-3-5-7-21-30-41(47)32-23-17-13-9-11-15-19-25-34-43(49)45-37-39-28-27-29-40(36-39)38-46-44(50)35-26-20-16-12-10-14-18-24-33-42(48)31-22-8-6-4-2/h27-29,36,41-42,47-48H,3-26,30-35,37-38H2,1-2H3,(H,45,49)(H,46,50)
InChI key:InChIKey=NOWNHFCLWUPOCO-UHFFFAOYSA-N
SMILES:C(NC(CCCCCCCCCCC(CCCCCC)O)=O)C1=CC(CNC(CCCCCCCCCCC(CCCCCC)O)=O)=CC=C1
Synonyms:- m-Xylylenebis(12-hydroxystearic acid amide)
- N,N′-[1,3-Phenylenebis(methylene)]bis[12-hydroxyoctadecanamide]
- Octadecanamide, N,N′-[1,3-phenylenebis(methylene)]bis[12-hydroxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.