CAS 128562-25-4
:4-Pyrrolidin-2-yl-pyridine
Description:
4-Pyrrolidin-2-yl-pyridine, identified by its CAS number 128562-25-4, is a chemical compound characterized by a pyridine ring substituted with a pyrrolidine group. This compound typically exhibits properties associated with both heterocyclic structures, which can influence its reactivity and interactions. It is a colorless to pale yellow liquid or solid, depending on the specific conditions and purity. The presence of the pyrrolidine moiety contributes to its potential as a ligand in coordination chemistry and its utility in medicinal chemistry, particularly in the development of pharmaceuticals. The compound may exhibit basic properties due to the nitrogen atoms in both the pyridine and pyrrolidine rings, allowing it to participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. Additionally, its structural features may impart specific biological activities, making it of interest in drug discovery and development. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C9H13N2
InChI:InChI=1/C9H12N2/c1-2-9(11-5-1)8-3-6-10-7-4-8/h3-4,6-7,9,11H,1-2,5H2/p+1/t9-/m1/s1
Synonyms:- 4-Pyrrolidin-2-Ylpyridine
- 4-(2-Pyrrolidinyl)Pyridine
- 2-(4-Pyridinyl)pyrrolidine
- 2-Oxo-3-(Thiophen-2-Yl)Propanoate
- (2S)-2-pyridin-4-ylpyrrolidinium
- (2R)-2-pyridin-4-ylpyrrolidinium
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-(2-Pyrrolidinyl)pyridine, 96%
CAS:4-(2-Pyrrolidinyl)pyridine can be used in aldol catalysis, in the preparation of azole compounds as 11-HSD1 inhibitors as well as in the asymetric synthesis of pyrazolodihydropyrimidinylpyrrolidin amide derivatives. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar
Formula:C7H5O3SPurity:96%Color and Shape:Clear yellow, LiquidMolecular weight:169.17Pyridine, 4-(2-pyrrolidinyl)-
CAS:Formula:C9H12N2Purity:95%Color and Shape:LiquidMolecular weight:148.20504-(Pyrrolidin-2-yl)pyridine
CAS:4-(Pyrrolidin-2-yl)pyridineFormula:C9H12N2Purity:96%Color and Shape: colourless to light yellow liquidMolecular weight:148.20g/mol4-Pyrrolidin-2-ylpyridine
CAS:Formula:C9H12N2Purity:95%Color and Shape:LiquidMolecular weight:148.209



