
CAS 128564-60-3
:5,6-Bis(4-methoxyphenyl)-1H-pyrazolo[3,4-b]pyrazine-1-ethanol
Description:
5,6-Bis(4-methoxyphenyl)-1H-pyrazolo[3,4-b]pyrazine-1-ethanol, with the CAS number 128564-60-3, is a synthetic organic compound characterized by its complex pyrazolo[3,4-b]pyrazine core structure, which is substituted at the 5 and 6 positions with 4-methoxyphenyl groups. This compound features an ethanol moiety at the 1-position, contributing to its solubility and potential biological activity. The presence of methoxy groups enhances its lipophilicity and may influence its interaction with biological targets. Typically, compounds of this class are studied for their potential pharmacological properties, including anti-inflammatory and anticancer activities. The molecular structure suggests the possibility of engaging in hydrogen bonding and π-π stacking interactions, which could be relevant in drug design and development. Its synthesis and characterization involve standard organic chemistry techniques, and it may be of interest in medicinal chemistry research due to its unique structural features and potential therapeutic applications.
Formula:C21H20N4O3
InChI:InChI=1S/C21H20N4O3/c1-27-16-7-3-14(4-8-16)19-20(15-5-9-17(28-2)10-6-15)24-21-18(23-19)13-22-25(21)11-12-26/h3-10,13,26H,11-12H2,1-2H3
InChI key:InChIKey=IFAZVRFZQLVQKB-UHFFFAOYSA-N
SMILES:C(CO)N1C2=NC(=C(N=C2C=N1)C3=CC=C(OC)C=C3)C4=CC=C(OC)C=C4
Synonyms:- 1H-Pyrazolo[3,4-b]pyrazine-1-ethanol, 5,6-bis(4-methoxyphenyl)-
- 5,6-Bis(4-methoxyphenyl)-1H-pyrazolo[3,4-b]pyrazine-1-ethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1H-Pyrazolo[3,4-b]pyrazine-1-ethanol, 5,6-bis(4-methoxyphenyl)-
CAS:Formula:C21H20N4O3Molecular weight:376.4085
