
CAS 128575-35-9
:2,2′-Bis(p-toluenesulfonyloxy)-1,1′-binaphthyl
Description:
2,2′-Bis(p-toluenesulfonyloxy)-1,1′-binaphthyl, with CAS number 128575-35-9, is a chemical compound characterized by its unique structure, which features two p-toluenesulfonyloxy groups attached to a binaphthyl backbone. This compound is typically used as a chiral auxiliary in asymmetric synthesis, facilitating the formation of enantiomerically enriched products. It exhibits good solubility in organic solvents, making it suitable for various chemical reactions. The presence of the sulfonyloxy groups enhances its reactivity, allowing it to participate in nucleophilic substitution reactions. Additionally, the binaphthyl moiety contributes to its optical properties, enabling applications in chiral resolution and catalysis. The compound is generally stable under standard laboratory conditions but should be handled with care due to the potential toxicity associated with sulfonyl compounds. Overall, 2,2′-Bis(p-toluenesulfonyloxy)-1,1′-binaphthyl is a valuable tool in synthetic organic chemistry, particularly in the development of chiral molecules.
Formula:C34H26O6S2
InChI:InChI=1S/C34H26O6S2/c1-23-11-17-27(18-12-23)41(35,36)39-31-21-15-25-7-3-5-9-29(25)33(31)34-30-10-6-4-8-26(30)16-22-32(34)40-42(37,38)28-19-13-24(2)14-20-28/h3-22H,1-2H3
InChI key:InChIKey=BKYJBVWKVKRIDN-UHFFFAOYSA-N
SMILES:O(S(=O)(=O)C1=CC=C(C)C=C1)C2=C(C3=C(C=C2)C=CC=C3)C=4C5=C(C=CC4OS(=O)(=O)C6=CC=C(C)C=C6)C=CC=C5
Synonyms:- [1,1′-Binaphthalene]-2,2′-diol, bis(4-methylbenzenesulfonate), (±)-
- [1,1′-binaphthalene]-2,2′-diyl bis(4-methylbenzenesulfonate)
- 2,2′-Bis(p-toluenesulfonyloxy)-1,1′-binaphthyl
- [1,1′-Binaphthalene]-2,2′-diol, 2,2′-bis(4-methylbenzenesulfonate)
- [1,1′-Binaphthalene]-2,2′-diol, bis(4-methylbenzenesulfonate)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
[1,1'-Binaphthalene]-2,2'-diol, 2,2'-bis(4-methylbenzenesulfonate)
CAS:Formula:C34H26O6S2Molecular weight:594.6966

