CAS 128577-47-9

4-BROMOMETHYL-3-FLUOROBENZOIC ACID METHYL ESTER

Description:

4-Bromomethyl-3-fluorobenzoic acid methyl ester, with the CAS number 128577-47-9, is an organic compound characterized by its aromatic structure, which includes a bromomethyl group and a fluorine atom attached to a benzoic acid derivative. This compound typically exhibits properties associated with both halogenated and ester functionalities, such as moderate polarity and potential reactivity in nucleophilic substitution reactions due to the presence of the bromine atom. The methyl ester group contributes to its solubility in organic solvents, making it useful in various chemical applications, including synthesis and as an intermediate in organic reactions. Additionally, the presence of the fluorine atom can enhance the compound's stability and influence its electronic properties, potentially affecting its reactivity and interactions with biological systems. Overall, 4-bromomethyl-3-fluorobenzoic acid methyl ester is a valuable compound in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals.

Formula: C₉H₈BrFO₂

InChI: InChI=1/C9H8BrFO2/c1-13-9(12)6-2-3-7(5-10)8(11)4-6/h2-4H,5H2,1H3

SMILES: COC(=O)c1ccc(CBr)c(c1)F

Synonyms:

• Mmethyl 4-(Bromomethyl)-3-Fluorobenzoate
• Methyl 4-(Bromomethyl)-3-Fluorobenzoate

Benzoic acid, 4-(bromomethyl)-3-fluoro-, methyl ester

CAS: 128577-47-9

Formula: C₉H₈BrFO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 247.0610

Ref: IN-DA000Y7K

Methyl 4-(bromomethyl)-3-fluorobenzoate

CAS: 128577-47-9

Methyl 4-(bromomethyl)-3-fluorobenzoate

Formula: C₉H₈BrFO₂

Purity: 95%

Color and Shape: white solid

Molecular weight: 247.06g/mol

Ref: 54-PC501461

Methyl 4-(bromomethyl)-3-fluorobenzoate

CAS: 128577-47-9

Formula: C₉H₈BrFO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 247.063

Ref: 10-F227754