CAS 128577-48-0

Methyl-2-bromo-4-bromomethylbenzoate

Description:

Methyl-2-bromo-4-bromomethylbenzoate is an organic compound characterized by its aromatic structure, which includes a benzoate moiety substituted with bromine atoms and a methyl ester group. The presence of multiple bromine substituents enhances its reactivity, making it a useful intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. This compound typically exhibits a moderate to high level of lipophilicity due to the aromatic ring and the ester functional group, which can influence its solubility in organic solvents. Additionally, the bromine atoms can participate in various chemical reactions, such as nucleophilic substitutions or cross-coupling reactions, facilitating the formation of more complex molecules. Safety considerations are important when handling this compound, as brominated compounds can pose health risks and environmental concerns. Proper storage and disposal methods should be followed to mitigate any potential hazards associated with its use.

Formula: C₉H₈Br₂O₂

InChI: InChI=1/C9H8Br2O2/c1-13-9(12)7-3-2-6(5-10)4-8(7)11/h2-4H,5H2,1H3

SMILES: COC(=O)c1ccc(cc1Br)CBr

Synonyms:

• Methyl 2-Bromo-4-(Bromomethyl)Benzoate

Benzoic acid, 2-bromo-4-(bromomethyl)-, methyl ester

CAS: 128577-48-0

Formula: C₉H₈Br₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 307.9666

Ref: IN-DA000Y7J

Methyl 2-bromo-4-(bromomethyl)benzoate

CAS: 128577-48-0

Methyl 2-bromo-4-(bromomethyl)benzoate

Purity: 97%

Molecular weight: 307.97g/mol

Ref: 54-OR480825

Methyl 2-bromo-4-(bromomethyl)benzoate

CAS: 128577-48-0

Formula: C₉H₈Br₂O₂

Purity: 97%(LC-MS);RG

Color and Shape: Solid

Molecular weight: 307.969

Ref: 10-F213221

Methyl-2-bromo-4-bromomethylbenzoate

Controlled Product

CAS: 128577-48-0

Applications Methyl-2-bromo-4-bromomethylbenzoate

Formula: C₉H₈Br₂O₂

Color and Shape: Neat

Molecular weight: 307.97

Ref: TR-M296273