CAS 128585-01-3
:4-{(1Z)-4-chloro-1-[4-(2-hydroxyethoxy)phenyl]-2-phenylbut-1-en-1-yl}phenol
Description:
The chemical substance known as 4-{(1Z)-4-chloro-1-[4-(2-hydroxyethoxy)phenyl]-2-phenylbut-1-en-1-yl}phenol, with the CAS number 128585-01-3, is a complex organic compound characterized by its multi-functional structure. It features a phenolic group, which contributes to its potential as an antioxidant and its reactivity in various chemical processes. The presence of a chloro substituent indicates potential for electrophilic reactions, while the hydroxyethoxy group enhances solubility in polar solvents and may influence biological activity. The compound's conjugated double bond system suggests it may exhibit interesting optical properties and reactivity, making it a candidate for applications in pharmaceuticals or materials science. Additionally, the presence of multiple aromatic rings may contribute to its stability and interaction with biological systems. Overall, this compound's unique structural features suggest it could have diverse applications, particularly in medicinal chemistry or as a functional material.
Formula:C24H23ClO3
InChI:InChI=1/C24H23ClO3/c25-15-14-23(18-4-2-1-3-5-18)24(19-6-10-21(27)11-7-19)20-8-12-22(13-9-20)28-17-16-26/h1-13,26-27H,14-17H2/b24-23-
SMILES:c1ccc(cc1)/C(=C(/c1ccc(cc1)O)\c1ccc(cc1)OCCO)/CCCl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
4-Hydroxy Ospemifene (Ospemifene Impurity)
CAS:Applications 4-Hydroxy Ospemifene is an Ospemifene (O703000) impurity, used to treat dyspareunia. It is a selective estrogen receptor modulator (SERM) acting similarly to an estrogen.
References Rutanen, E., et al.: Menopause, 10, 433 (2003);Formula:C24H23ClO3Color and Shape:NeatMolecular weight:394.89

