CAS 128593-72-6
:(R)-N-(2-Propyl)-1-phenylethylamine hydrochloride
Description:
(R)-N-(2-Propyl)-1-phenylethylamine hydrochloride, with the CAS number 128593-72-6, is a chiral amine characterized by its specific stereochemistry, which is crucial for its biological activity. This compound features a phenylethylamine backbone, with a propyl group attached to the nitrogen atom, contributing to its hydrophobic properties. As a hydrochloride salt, it is typically more soluble in water than its free base form, enhancing its utility in various applications, including pharmaceuticals. The presence of the amine functional group allows for potential interactions with biological targets, making it of interest in medicinal chemistry. Its chirality may influence its pharmacokinetics and pharmacodynamics, leading to different effects compared to its enantiomer. The compound's stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature. Overall, (R)-N-(2-Propyl)-1-phenylethylamine hydrochloride is a significant compound in the study of chiral amines and their applications in drug development and synthesis.
Formula:C11H17N
InChI:InChI=1/C11H17N/c1-9(2)12-10(3)11-7-5-4-6-8-11/h4-10,12H,1-3H3/t10-/m1/s1
SMILES:CC(C)N[C@H](C)c1ccccc1
Synonyms:- (R)-N-Isopropyl-1-phenylethylamine hydrochloride
- N-[(1R)-1-phenylethyl]propan-2-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Benzenemethanamine, α-methyl-N-(1-methylethyl)-, hydrochloride (1:1), (αR)-
CAS:Formula:C11H18ClNMolecular weight:199.7203

