
CAS 128595-42-6
:D-Alanine, anhydride with phosphoric acid (1:1)
Description:
D-Alanine, anhydride with phosphoric acid (1:1), identified by the CAS number 128595-42-6, is a chemical compound that combines the amino acid D-alanine with phosphoric acid. This compound typically exhibits characteristics associated with both its amino acid and phosphoric acid components. D-Alanine is a non-essential amino acid that plays a crucial role in protein synthesis and is involved in various metabolic processes. The presence of phosphoric acid suggests that the compound may have acidic properties, potentially influencing its solubility and reactivity in aqueous solutions. The anhydride formation indicates that the compound may have a higher reactivity compared to its individual components, particularly in biochemical contexts. This compound may be of interest in biochemical research, particularly in studies related to amino acid metabolism, peptide synthesis, or as a potential intermediate in organic synthesis. Its specific applications and behavior would depend on the conditions under which it is used, including pH, temperature, and the presence of other reactants.
Formula:C3H8NO5P
InChI:InChI=1S/C3H8NO5P/c1-2(4)3(5)9-10(6,7)8/h2H,4H2,1H3,(H2,6,7,8)/t2-/m1/s1
InChI key:InChIKey=HNBPGMZUKDCQEE-UWTATZPHSA-N
SMILES:C(OP(=O)(O)O)([C@@H](C)N)=O
Synonyms:- D-Alanine, monoanhydride with phosphoric acid
- D-Alanine, anhydride with phosphoric acid (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Alanylphosphate
CAS:Alanylphosphate is a biochemical.Formula:C3H8NO5PColor and Shape:SolidMolecular weight:169.07

