CAS 1286207-09-7

Benzamide, 2-fluoro-N-(3R)-3-piperidinyl-, hydrochloride (1:1)

Description:

Benzamide, 2-fluoro-N-(3R)-3-piperidinyl-, hydrochloride (1:1) is a chemical compound characterized by its benzamide structure, which includes a fluorine atom at the 2-position of the benzene ring and a piperidine moiety attached to the nitrogen of the amide group. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and facilitates its use in various applications, particularly in pharmaceutical research. The presence of the piperidine ring suggests potential biological activity, as piperidine derivatives are often explored for their pharmacological properties. The specific stereochemistry indicated by the (3R) designation implies that the piperidine ring has a defined spatial arrangement, which can significantly influence the compound's interaction with biological targets. Overall, this compound's unique structural features may contribute to its potential utility in medicinal chemistry, particularly in the development of therapeutic agents. As with many chemical substances, safety and handling precautions should be observed due to its potential biological activity.

Formula: C₁₂H₁₅FN₂O·ClH

InChI: InChI=1S/C12H15FN2O.ClH/c13-11-6-2-1-5-10(11)12(16)15-9-4-3-7-14-8-9;/h1-2,5-6,9,14H,3-4,7-8H2,(H,15,16);1H/t9-;/m1./s1

InChI key: InChIKey=UHYLZZUWQPQMBN-SBSPUUFOSA-N

SMILES: C(N[C@@H]1CCCNC1)(=O)C2=C(F)C=CC=C2.Cl

Synonyms:

• Benzamide, 2-fluoro-N-(3R)-3-piperidinyl-, hydrochloride (1:1)

(R)-2-Fluoro-N-(piperidin-3-yl)benzamidehydrochloride

CAS: 1286207-09-7

Formula: C₁₂H₁₆ClFN₂O

Purity: 95.0%

Molecular weight: 258.72

Ref: 10-F064382