CAS 1286207-30-4

Pyrrolidine, 3-(4-nitrophenoxy)-, hydrochloride (1:1), (3S)-

Description:

Pyrrolidine, 3-(4-nitrophenoxy)-, hydrochloride (1:1), (3S)- is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered saturated heterocycle containing one nitrogen atom. The presence of the 4-nitrophenoxy group indicates that a nitrophenyl moiety is attached to the pyrrolidine at the 3-position, contributing to its chemical reactivity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, including pharmaceuticals. The (3S)- designation refers to the specific stereochemistry of the compound, indicating that it has a particular spatial arrangement of atoms that can influence its biological interactions and properties. This compound may exhibit properties such as being a potential intermediate in organic synthesis or having specific pharmacological effects, although detailed studies would be necessary to elucidate its full profile. Safety and handling precautions should be observed, as with any chemical substance, particularly those with nitro groups, which can be sensitive to reduction reactions.

Formula: C₁₀H₁₂N₂O₃·ClH

InChI: InChI=1S/C10H12N2O3.ClH/c13-12(14)8-1-3-9(4-2-8)15-10-5-6-11-7-10;/h1-4,10-11H,5-7H2;1H/t10-;/m0./s1

InChI key: InChIKey=KMTLAWJEKPIRFL-PPHPATTJSA-N

SMILES: O(C1=CC=C(N(=O)=O)C=C1)[C@H]2CCNC2.Cl

Synonyms:

• (S)-3-(4-Nitrophenoxy)pyrrolidine HCl
• Pyrrolidine, 3-(4-nitrophenoxy)-, hydrochloride (1:1), (3S)-
• (S)-3-(4-Nitrophenoxy)pyrrolidine hydrochloride