CAS 1286207-32-6

Pyridine, 3-nitro-2-[(3S)-3-pyrrolidinyloxy]-, hydrochloride (1:1)

Description:

Pyridine, 3-nitro-2-[(3S)-3-pyrrolidinyloxy]-, hydrochloride (1:1) is a chemical compound characterized by its pyridine and pyrrolidine moieties, which contribute to its biological activity and potential applications in medicinal chemistry. The presence of a nitro group at the 3-position of the pyridine ring enhances its reactivity and may influence its pharmacological properties. As a hydrochloride salt, it is typically more soluble in water, facilitating its use in various biological assays and formulations. The compound's stereochemistry, indicated by the (3S) designation, suggests specific spatial arrangements that can affect its interaction with biological targets. This compound may exhibit properties such as antimicrobial, anti-inflammatory, or neuroprotective effects, making it of interest in drug development. However, detailed studies on its toxicity, efficacy, and mechanism of action would be necessary to fully understand its potential applications. As with many nitrogen-containing heterocycles, it may also participate in various chemical reactions, making it a versatile building block in organic synthesis.

Formula: C₉H₁₁N₃O₃·ClH

InChI: InChI=1S/C9H11N3O3.ClH/c13-12(14)8-2-1-4-11-9(8)15-7-3-5-10-6-7;/h1-2,4,7,10H,3,5-6H2;1H/t7-;/m0./s1

InChI key: InChIKey=BIRWQHLYSQIAQQ-FJXQXJEOSA-N

SMILES: O(C1=C(N(=O)=O)C=CC=N1)[C@H]2CCNC2.Cl

Synonyms:

• Pyridine, 3-nitro-2-[(3S)-3-pyrrolidinyloxy]-, hydrochloride (1:1)

(S)-3-Nitro-2-(pyrrolidin-3-yloxy)pyridine hydrochloride

CAS: 1286207-32-6

Formula: C₉H₁₂ClN₃O₃

Purity: 95.0%

Molecular weight: 245.66

Ref: 10-F063887