CAS 1286207-52-0

3-Pyrrolidinamine, 1-(2-methylpropyl)-, hydrochloride (1:2), (3R)-

Description:

3-Pyrrolidinamine, 1-(2-methylpropyl)-, hydrochloride (1:2), (3R)- is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered nitrogen-containing heterocycle. The compound features a side chain with a branched alkyl group, specifically 2-methylpropyl, contributing to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical formulations. The (3R)- designation indicates the specific stereochemistry at the chiral center, which can significantly influence the biological activity and interaction with receptors. This compound may exhibit properties relevant to medicinal chemistry, potentially acting as a precursor or intermediate in the synthesis of biologically active molecules. Its safety, handling, and regulatory considerations would depend on its specific applications and the context of use, necessitating adherence to appropriate guidelines for chemical substances.

Formula: C₈H₁₈N₂·2ClH

InChI: InChI=1S/C8H18N2.2ClH/c1-7(2)5-10-4-3-8(9)6-10;;/h7-8H,3-6,9H2,1-2H3;2*1H/t8-;;/m1../s1

InChI key: InChIKey=RFICWJOZWCOIDQ-YCBDHFTFSA-N

SMILES: C(C(C)C)N1C[C@H](N)CC1.Cl

Synonyms:

• 3-Pyrrolidinamine, 1-(2-methylpropyl)-, hydrochloride (1:2), (3R)-

(R)-1-Isobutylpyrrolidin-3-amine dihydrochloride

CAS: 1286207-52-0

Formula: C₈H₂₀Cl₂N₂

Purity: 95.0%

Molecular weight: 215.16

Ref: 10-F064241