CAS 1286207-57-5

[(3S)-3-Amino-1-pyrrolidinyl](4-fluorophenyl)methanone

Description:

[(3S)-3-Amino-1-pyrrolidinyl](4-fluorophenyl)methanone, with the CAS number 1286207-57-5, is a chemical compound characterized by its unique structural features. It contains a pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle, and an amino group that contributes to its potential biological activity. The presence of a 4-fluorophenyl group indicates that there is a fluorine atom substituted on a phenyl ring, which can influence the compound's pharmacological properties, such as its lipophilicity and binding affinity to biological targets. This compound may exhibit properties relevant to medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with various biological systems. Its stereochemistry, specifically the (3S) configuration, suggests that it may have specific interactions with chiral environments, which is crucial in drug design. Overall, this compound's characteristics make it a subject of interest in research related to drug discovery and development.

Formula: C₁₁H₁₃FN₂O

InChI: InChI=1S/C11H13FN2O/c12-9-3-1-8(2-4-9)11(15)14-6-5-10(13)7-14/h1-4,10H,5-7,13H2/t10-/m0/s1

InChI key: InChIKey=SNSRVOBBDAUXAP-JTQLQIEISA-N

SMILES: C(=O)(N1C[C@@H](N)CC1)C2=CC=C(F)C=C2

Synonyms:

• [(3S)-3-Amino-1-pyrrolidinyl](4-fluorophenyl)methanone
• Methanone, [(3S)-3-amino-1-pyrrolidinyl](4-fluorophenyl)-
• (3s)-1-(4-Fluorobenzoyl)pyrrolidin-3-amine
• (S)-(3-Aminopyrrolidin-1-yl)(4-fluorophenyl)methanone

(S)-(3-Aminopyrrolidin-1-yl)(4-fluorophenyl)methanone

CAS: 1286207-57-5

Purity: 95.0%

Molecular weight: 208.23599243164062

Ref: 10-F064264

(3S)-1-(4-Fluorobenzoyl)pyrrolidin-3-amine

CAS: 1286207-57-5

Versatile small molecule scaffold

Formula: C₁₁H₁₃FN₂O

Purity: Min. 95%

Molecular weight: 208.23 g/mol

Ref: 3D-LBC20757