CAS 1286207-67-7

[(3R)-3-Amino-1-pyrrolidinyl](2-fluorophenyl)methanone

Description:

[(3R)-3-Amino-1-pyrrolidinyl](2-fluorophenyl)methanone, identified by its CAS number 1286207-67-7, is a chemical compound characterized by its unique structural features. It contains a pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle, and an amino group that contributes to its potential biological activity. The presence of a 2-fluorophenyl group indicates that a fluorine atom is substituted on the phenyl ring, which can influence the compound's electronic properties and reactivity. This compound may exhibit interesting pharmacological properties due to its structural motifs, making it a candidate for research in medicinal chemistry. Its stereochemistry, particularly the (3R) configuration, suggests specific spatial arrangements that can affect its interaction with biological targets. Overall, this compound's characteristics, including its molecular structure and functional groups, position it as a subject of interest in the development of new therapeutic agents. Further studies would be necessary to elucidate its specific properties and potential applications in various fields, including pharmaceuticals and biochemistry.

Formula: C₁₁H₁₃FN₂O

InChI: InChI=1S/C11H13FN2O/c12-10-4-2-1-3-9(10)11(15)14-6-5-8(13)7-14/h1-4,8H,5-7,13H2/t8-/m1/s1

InChI key: InChIKey=IZCATAVQVSUQAM-MRVPVSSYSA-N

SMILES: C(=O)(C1=C(F)C=CC=C1)N2C[C@H](N)CC2

Synonyms:

• [(3R)-3-Amino-1-pyrrolidinyl](2-fluorophenyl)methanone
• Methanone, [(3R)-3-amino-1-pyrrolidinyl](2-fluorophenyl)-

(R)-(3-Aminopyrrolidin-1-yl)(2-fluorophenyl)methanone

CAS: 1286207-67-7

Formula: C₁₁H₁₃FN₂O

Purity: 95.0%

Molecular weight: 208.236

Ref: 10-F064271