CAS 1286207-73-5

Benzamide, 3-fluoro-N-(3R)-3-piperidinyl-, hydrochloride (1:1)

Description:

Benzamide, 3-fluoro-N-(3R)-3-piperidinyl-, hydrochloride (1:1) is a chemical compound characterized by its benzamide structure, which features a benzene ring attached to a carbonyl group (amide). The presence of a fluorine atom at the 3-position of the benzamide enhances its chemical reactivity and may influence its biological activity. The piperidine moiety, specifically in the 3R configuration, contributes to the compound's potential pharmacological properties, as piperidine derivatives are often associated with various therapeutic effects. The hydrochloride salt form indicates that the compound is protonated, which can enhance its solubility in water and facilitate its use in biological systems. This compound may be of interest in medicinal chemistry and drug development, particularly in the context of designing agents that interact with specific biological targets. Its unique structural features suggest potential applications in areas such as neuropharmacology or as a lead compound for further modifications. As with any chemical substance, safety and handling precautions should be observed due to its potential biological activity.

Formula: C₁₂H₁₅FN₂O·ClH

InChI: InChI=1S/C12H15FN2O.ClH/c13-10-4-1-3-9(7-10)12(16)15-11-5-2-6-14-8-11;/h1,3-4,7,11,14H,2,5-6,8H2,(H,15,16);1H/t11-;/m1./s1

InChI key: InChIKey=HFWMLIINMFOKBE-RFVHGSKJSA-N

SMILES: C(N[C@@H]1CCCNC1)(=O)C2=CC(F)=CC=C2.Cl

Synonyms:

• Benzamide, 3-fluoro-N-(3R)-3-piperidinyl-, hydrochloride (1:1)

(R)-3-Fluoro-N-(piperidin-3-yl)benzamidehydrochloride

CAS: 1286207-73-5

Formula: C₁₂H₁₆ClFN₂O

Purity: 95.0%

Molecular weight: 258.72

Ref: 10-F064384