CAS 1286207-77-9

1,1-Dimethylethyl (3S)-3-[(4-fluorobenzoyl)amino]-1-piperidinecarboxylate

Description:

1,1-Dimethylethyl (3S)-3-[(4-fluorobenzoyl)amino]-1-piperidinecarboxylate, identified by its CAS number 1286207-77-9, is a chemical compound characterized by its complex structure, which includes a piperidine ring and a fluorobenzoyl group. This compound features a tert-butyl group (1,1-dimethylethyl) that contributes to its steric bulk, potentially influencing its biological activity and solubility. The presence of the fluorobenzoyl moiety suggests that it may exhibit specific interactions with biological targets, making it of interest in medicinal chemistry. The (3S) configuration indicates that it has a specific stereochemistry, which can significantly affect its pharmacological properties. Additionally, the carboxylate functional group may play a role in its reactivity and solubility in various solvents. Overall, this compound's unique structural features suggest potential applications in drug development, particularly in the design of therapeutics targeting specific biological pathways. Further studies would be necessary to elucidate its full range of properties and potential uses.

Formula: C₁₇H₂₃FN₂O₃

InChI: InChI=1S/C17H23FN2O3/c1-17(2,3)23-16(22)20-10-4-5-14(11-20)19-15(21)12-6-8-13(18)9-7-12/h6-9,14H,4-5,10-11H2,1-3H3,(H,19,21)/t14-/m0/s1

InChI key: InChIKey=PQFMAQKAXRBBJD-AWEZNQCLSA-N

SMILES: N(C(=O)C1=CC=C(F)C=C1)[C@@H]2CN(C(OC(C)(C)C)=O)CCC2

Synonyms:

• 1,1-Dimethylethyl (3S)-3-[(4-fluorobenzoyl)amino]-1-piperidinecarboxylate
• 1-Piperidinecarboxylic acid, 3-[(4-fluorobenzoyl)amino]-, 1,1-dimethylethyl ester, (3S)-

(S)-tert-Butyl 3-[(4-fluorobenzene)carbonylamino]piperidine-1-carboxylate

CAS: 1286207-77-9

Formula: C₁₇H₂₃FN₂O₃

Purity: 95.0%

Molecular weight: 322.38

Ref: 10-F064431