CAS 1286207-83-7

1,1-Dimethylethyl N-[(3S)-1-(2-methylpropyl)-3-pyrrolidinyl]carbamate

Description:

1,1-Dimethylethyl N-[(3S)-1-(2-methylpropyl)-3-pyrrolidinyl]carbamate, identified by its CAS number 1286207-83-7, is a chemical compound characterized by its unique structural features, including a carbamate functional group and a pyrrolidine ring. This compound is typically classified as an organic molecule and may exhibit properties such as moderate solubility in organic solvents and potential bioactivity due to its pyrrolidine moiety. The presence of the tert-butyl group (1,1-dimethylethyl) suggests steric hindrance, which can influence its reactivity and interactions with biological targets. Additionally, the stereochemistry indicated by the (3S) configuration may play a crucial role in its pharmacological properties, affecting how it interacts with enzymes or receptors in biological systems. Overall, this compound's characteristics make it of interest in medicinal chemistry and drug development, particularly in the context of designing compounds with specific biological activities.

Formula: C₁₃H₂₆N₂O₂

InChI: InChI=1S/C13H26N2O2/c1-10(2)8-15-7-6-11(9-15)14-12(16)17-13(3,4)5/h10-11H,6-9H2,1-5H3,(H,14,16)/t11-/m0/s1

InChI key: InChIKey=MKWVEGFRVLKKGA-NSHDSACASA-N

SMILES: N(C(OC(C)(C)C)=O)[C@@H]1CN(CC(C)C)CC1

Synonyms:

• Carbamic acid, N-[(3S)-1-(2-methylpropyl)-3-pyrrolidinyl]-, 1,1-dimethylethyl ester
• tert-Butyl N-[(3S)-1-(2-methylpropyl)pyrrolidin-3-yl]carbamate
• 1,1-Dimethylethyl N-[(3S)-1-(2-methylpropyl)-3-pyrrolidinyl]carbamate

(S)-tert-Butyl 1-isobutylpyrrolidin-3-ylcarbamate

CAS: 1286207-83-7

Formula: C₁₃H₂₆N₂O₂

Purity: 95.0%

Molecular weight: 242.363

Ref: 10-F063951