CAS 1286207-88-2

1,1-Dimethylethyl (3S)-3-[[(3-fluorophenyl)methyl]amino]-1-piperidinecarboxylate

Description:

1,1-Dimethylethyl (3S)-3-[[(3-fluorophenyl)methyl]amino]-1-piperidinecarboxylate, identified by its CAS number 1286207-88-2, is a chemical compound characterized by its complex structure, which includes a piperidine ring and a carboxylate functional group. The presence of a dimethyl group and a fluorophenyl moiety contributes to its unique properties, potentially influencing its solubility, reactivity, and biological activity. This compound may exhibit specific stereochemistry due to the (3S) configuration, which can affect its interaction with biological targets, making it of interest in medicinal chemistry. The fluorine atom in the phenyl ring can enhance lipophilicity and metabolic stability, which are important factors in drug design. Additionally, the amino group suggests potential for hydrogen bonding, which could play a role in its pharmacodynamics. Overall, this compound's characteristics make it a candidate for further investigation in pharmaceutical applications, particularly in the development of therapeutics targeting specific biological pathways.

Formula: C₁₇H₂₅FN₂O₂

InChI: InChI=1S/C17H25FN2O2/c1-17(2,3)22-16(21)20-9-5-8-15(12-20)19-11-13-6-4-7-14(18)10-13/h4,6-7,10,15,19H,5,8-9,11-12H2,1-3H3/t15-/m0/s1

InChI key: InChIKey=PKADNTNWLFEQPF-HNNXBMFYSA-N

SMILES: N(CC1=CC(F)=CC=C1)[C@@H]2CN(C(OC(C)(C)C)=O)CCC2

(S)-tert-Butyl 3-[(3-fluorophenyl)methyl]aminopiperidine-1-carboxylate

CAS: 1286207-88-2

Formula: C₁₇H₂₅FN₂O₂

Purity: 95.0%

Molecular weight: 308.397

Ref: 10-F064436