CAS 1286207-93-9

1,1-Dimethylethyl N-[(3R)-1-(3-pyridinylmethyl)-3-pyrrolidinyl]carbamate

Description:

1,1-Dimethylethyl N-[(3R)-1-(3-pyridinylmethyl)-3-pyrrolidinyl]carbamate, identified by its CAS number 1286207-93-9, is a chemical compound characterized by its complex structure, which includes a carbamate functional group and a pyrrolidine ring. This compound typically exhibits properties associated with both amines and carbamates, such as potential solubility in polar solvents and the ability to form hydrogen bonds due to the presence of nitrogen and oxygen atoms. The presence of the pyridine moiety suggests potential interactions with biological systems, making it of interest in pharmaceutical applications. Its stereochemistry, indicated by the (3R) configuration, may influence its biological activity and interactions. Additionally, the dimethyl group contributes to steric hindrance, which can affect the compound's reactivity and binding affinity in biological contexts. Overall, this compound's unique structural features position it as a candidate for further research in medicinal chemistry and related fields.

Formula: C₁₅H₂₃N₃O₂

InChI: InChI=1S/C15H23N3O2/c1-15(2,3)20-14(19)17-13-6-8-18(11-13)10-12-5-4-7-16-9-12/h4-5,7,9,13H,6,8,10-11H2,1-3H3,(H,17,19)/t13-/m1/s1

InChI key: InChIKey=RHHIPAUQALUPAC-CYBMUJFWSA-N

SMILES: C(N1C[C@H](NC(OC(C)(C)C)=O)CC1)C=2C=CC=NC2

Synonyms:

• Carbamic acid, N-[(3R)-1-(3-pyridinylmethyl)-3-pyrrolidinyl]-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl N-[(3R)-1-(3-pyridinylmethyl)-3-pyrrolidinyl]carbamate

(R)-tert-Butyl 1-(pyridin-3-ylmethyl)pyrrolidin-3-ylcarbamate

CAS: 1286207-93-9

Formula: C₁₅H₂₃N₃O₂

Purity: 95.0%

Molecular weight: 277.368

Ref: 10-F064226