CAS 1286208-09-0

3-Pyrrolidinamine, 1-[(2-chlorophenyl)methyl]-, hydrochloride (1:2), (3R)-

Description:

3-Pyrrolidinamine, 1-[(2-chlorophenyl)methyl]-, hydrochloride (1:2), (3R)- is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered nitrogen-containing heterocycle. The presence of a 2-chlorobenzyl group indicates that the compound has a chlorinated aromatic moiety, contributing to its potential biological activity. As a hydrochloride salt, it is typically more soluble in water than its free base form, which can enhance its pharmacokinetic properties. The (3R)- designation suggests that the compound has a specific stereochemistry at the pyrrolidine nitrogen, which can influence its interaction with biological targets, such as receptors or enzymes. This compound may be of interest in medicinal chemistry and pharmacology due to its structural features, which could be associated with various therapeutic effects. However, detailed information regarding its specific applications, safety profile, and biological activity would require further investigation and research.

Formula: C₁₁H₁₅ClN₂·2ClH

InChI: InChI=1S/C11H15ClN2.2ClH/c12-11-4-2-1-3-9(11)7-14-6-5-10(13)8-14;;/h1-4,10H,5-8,13H2;2*1H/t10-;;/m1../s1

InChI key: InChIKey=YNLUWWWFIYZSMF-YQFADDPSSA-N

SMILES: C(C1=C(Cl)C=CC=C1)N2C[C@H](N)CC2.Cl

Synonyms:

• 3-Pyrrolidinamine, 1-[(2-chlorophenyl)methyl]-, hydrochloride (1:2), (3R)-

(R)-1-(2-Chlorobenzyl)pyrrolidin-3-aminedihydrochloride

CAS: 1286208-09-0

Formula: C₁₁H₁₇Cl₃N₂

Purity: 95.0%

Molecular weight: 283.62

Ref: 10-F064247