CAS 1286208-10-3

Pyrrolidine, 3-(2-fluoro-6-nitrophenoxy)-, hydrochloride (1:1), (3R)-

Description:

Pyrrolidine, 3-(2-fluoro-6-nitrophenoxy)-, hydrochloride (1:1), (3R)- is a chemical compound characterized by its pyrrolidine backbone, which is a five-membered saturated heterocyclic amine. The presence of a 2-fluoro-6-nitrophenoxy group indicates that the compound has both fluorine and nitro substituents on a phenyl ring, contributing to its potential reactivity and biological activity. The hydrochloride form suggests that the compound is a salt, which typically enhances its solubility in water and may influence its pharmacokinetic properties. The (3R)- designation indicates that the compound has a specific stereochemistry at the pyrrolidine ring, which can be crucial for its biological interactions and efficacy. Such compounds are often studied for their potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of functional groups like nitro and fluoro can also suggest potential uses in agrochemicals or as intermediates in organic synthesis. Overall, the compound's unique structure and functional groups make it of interest in various fields of chemical research.

Formula: C₁₀H₁₁FN₂O₃·ClH

InChI: InChI=1S/C10H11FN2O3.ClH/c11-8-2-1-3-9(13(14)15)10(8)16-7-4-5-12-6-7;/h1-3,7,12H,4-6H2;1H/t7-;/m1./s1

InChI key: InChIKey=GZDMJISBKJVZFO-OGFXRTJISA-N

SMILES: O(C1=C(N(=O)=O)C=CC=C1F)[C@@H]2CCNC2.Cl

Synonyms:

• Pyrrolidine, 3-(2-fluoro-6-nitrophenoxy)-, hydrochloride (1:1), (3R)-

(R)-3-(2-Fluoro-6-nitrophenoxy)pyrrolidine hydrochloride

CAS: 1286208-10-3

Formula: C₁₀H₁₂ClFN₂O₃

Purity: 95.0%

Molecular weight: 262.67

Ref: 10-F063863