CAS 1286208-15-8

1-Pyrrolidinecarboxamide, N-(3R)-3-piperidinyl-, hydrochloride (1:1)

Description:

1-Pyrrolidinecarboxamide, N-(3R)-3-piperidinyl-, hydrochloride (1:1) is a chemical compound characterized by its structural features, which include a pyrrolidine ring and a piperidine moiety. This compound is typically encountered as a hydrochloride salt, enhancing its solubility in aqueous solutions, which is advantageous for pharmaceutical applications. The presence of the amide functional group contributes to its potential biological activity, making it of interest in medicinal chemistry. The specific stereochemistry indicated by the (3R) designation suggests that the compound may exhibit chiral properties, which can influence its pharmacodynamics and pharmacokinetics. As with many compounds in this class, it may interact with various biological targets, potentially affecting neurotransmitter systems or other physiological pathways. Safety and handling considerations are essential, as with any chemical substance, particularly in research and therapeutic contexts. Overall, this compound's unique structural characteristics and potential biological implications make it a subject of interest in chemical and pharmaceutical research.

Formula: C₁₀H₁₉N₃O·ClH

InChI: InChI=1S/C10H19N3O.ClH/c14-10(13-6-1-2-7-13)12-9-4-3-5-11-8-9;/h9,11H,1-8H2,(H,12,14);1H/t9-;/m1./s1

InChI key: InChIKey=FKIZOZAWWPEHSZ-SBSPUUFOSA-N

SMILES: C(N[C@@H]1CCCNC1)(=O)N2CCCC2.Cl

Synonyms:

• 1-Pyrrolidinecarboxamide, N-(3R)-3-piperidinyl-, hydrochloride (1:1)

(R)-N-(Piperidin-3-yl)pyrrolidine-1-carboxamide hydrochloride

CAS: 1286208-15-8

Formula: C₁₀H₂₀ClN₃O

Purity: 95.0%

Molecular weight: 233.74

Ref: 10-F064426