CAS 1286208-40-9

1,1-Dimethylethyl N-[(3R)-1-[(2-methoxyphenyl)methyl]-3-pyrrolidinyl]carbamate

Description:

1,1-Dimethylethyl N-[(3R)-1-[(2-methoxyphenyl)methyl]-3-pyrrolidinyl]carbamate, identified by its CAS number 1286208-40-9, is a chemical compound characterized by its complex structure, which includes a carbamate functional group and a pyrrolidine ring. This compound features a dimethyl group attached to a tert-butyl moiety, contributing to its steric bulk. The presence of a methoxyphenyl group indicates potential for aromatic interactions, while the pyrrolidine ring suggests possible conformational flexibility and interactions with biological targets. The stereochemistry at the pyrrolidine position is significant, as it may influence the compound's biological activity and pharmacokinetics. Typically, compounds of this nature are investigated for their potential therapeutic applications, particularly in the fields of medicinal chemistry and drug development. The specific characteristics, such as solubility, stability, and reactivity, would depend on the compound's molecular interactions and the environment in which it is studied. Overall, this compound represents a class of molecules that may exhibit interesting biological properties due to their structural features.

Formula: C₁₇H₂₆N₂O₃

InChI: InChI=1S/C17H26N2O3/c1-17(2,3)22-16(20)18-14-9-10-19(12-14)11-13-7-5-6-8-15(13)21-4/h5-8,14H,9-12H2,1-4H3,(H,18,20)/t14-/m1/s1

InChI key: InChIKey=JUSOQPBZYMQCSL-CQSZACIVSA-N

SMILES: C(C1=C(OC)C=CC=C1)N2C[C@H](NC(OC(C)(C)C)=O)CC2

Synonyms:

• 1,1-Dimethylethyl N-[(3R)-1-[(2-methoxyphenyl)methyl]-3-pyrrolidinyl]carbamate
• Carbamic acid, N-[(3R)-1-[(2-methoxyphenyl)methyl]-3-pyrrolidinyl]-, 1,1-dimethylethyl ester

(R)-tert-Butyl 1-(2-methoxybenzyl)pyrrolidin-3-ylcarbamate

CAS: 1286208-40-9

Formula: C₁₇H₂₆N₂O₃

Purity: 95.0%

Molecular weight: 306.406

Ref: 10-F064235