CAS 1286208-50-1

1,1-Dimethylethyl N-[(3R)-1-(2,2-dimethylpropyl)-3-pyrrolidinyl]carbamate

Description:

1,1-Dimethylethyl N-[(3R)-1-(2,2-dimethylpropyl)-3-pyrrolidinyl]carbamate, identified by its CAS number 1286208-50-1, is a chemical compound characterized by its unique structural features, including a carbamate functional group and a pyrrolidine ring. This compound is typically classified as an organic molecule, and its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of the dimethyl and isopropyl groups indicates that it may exhibit significant steric hindrance, which can influence its biological activity and interactions with other molecules. Additionally, the chirality at the pyrrolidine center implies that it may exist in enantiomeric forms, potentially leading to different pharmacological effects. Its solubility, stability, and reactivity would depend on the specific conditions, such as pH and temperature, making it important to consider these factors in practical applications. Overall, this compound's unique characteristics make it a subject of interest for further research in various chemical and biological contexts.

Formula: C₁₄H₂₈N₂O₂

InChI: InChI=1S/C14H28N2O2/c1-13(2,3)10-16-8-7-11(9-16)15-12(17)18-14(4,5)6/h11H,7-10H2,1-6H3,(H,15,17)/t11-/m1/s1

InChI key: InChIKey=ZUNQDTVACYAOIU-LLVKDONJSA-N

SMILES: N(C(OC(C)(C)C)=O)[C@H]1CN(CC(C)(C)C)CC1

Synonyms:

• 1,1-Dimethylethyl N-[(3R)-1-(2,2-dimethylpropyl)-3-pyrrolidinyl]carbamate
• Carbamic acid, N-[(3R)-1-(2,2-dimethylpropyl)-3-pyrrolidinyl]-, 1,1-dimethylethyl ester

(R)-tert-Butyl 1-neopentylpyrrolidin-3-ylcarbamate

CAS: 1286208-50-1

Formula: C₁₄H₂₈N₂O₂

Purity: 95.0%

Molecular weight: 256.39

Ref: 10-F063971