CAS 1286208-64-7

[(3R)-3-Amino-1-pyrrolidinyl](4-fluorophenyl)methanone

Description:

[(3R)-3-Amino-1-pyrrolidinyl](4-fluorophenyl)methanone, identified by its CAS number 1286208-64-7, is a chemical compound characterized by its unique structural features. It contains a pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle, and an amino group that contributes to its basicity and potential for forming hydrogen bonds. The presence of a 4-fluorophenyl group indicates that there is a fluorine atom attached to a phenyl ring, which can influence the compound's electronic properties and biological activity. This compound may exhibit interesting pharmacological properties due to its structural motifs, making it a subject of interest in medicinal chemistry. Its stereochemistry, specifically the (3R) configuration, suggests that it may have specific interactions with biological targets, potentially affecting its efficacy and safety profile. Overall, the characteristics of this compound make it a valuable candidate for further research in drug development and related fields.

Formula: C₁₁H₁₃FN₂O

InChI: InChI=1S/C11H13FN2O/c12-9-3-1-8(2-4-9)11(15)14-6-5-10(13)7-14/h1-4,10H,5-7,13H2/t10-/m1/s1

InChI key: InChIKey=SNSRVOBBDAUXAP-SNVBAGLBSA-N

SMILES: C(=O)(N1C[C@H](N)CC1)C2=CC=C(F)C=C2

Synonyms:

• [(3R)-3-Amino-1-pyrrolidinyl](4-fluorophenyl)methanone
• Methanone, [(3R)-3-amino-1-pyrrolidinyl](4-fluorophenyl)-

(R)-(3-Aminopyrrolidin-1-yl)(4-fluorophenyl)methanone

CAS: 1286208-64-7

Formula: C₁₁H₁₃FN₂O

Purity: 95.0%

Molecular weight: 208.236

Ref: 10-F064273